About 5-azidohex-1-yne
5-azidohex-1-yne (PubChem CID 89255941) has the molecular formula C6H9N3
and a molecular weight of 123.16 g/mol. Its IUPAC name is 5-azidohex-1-yne.
Molecular Properties
| Compound Name | 5-azidohex-1-yne |
| PubChem CID | 89255941 |
| Molecular Formula | C6H9N3 |
| Molecular Weight | 123.16 g/mol |
| Exact Mass | 123.08 |
| IUPAC Name | 5-azidohex-1-yne |
| SMILES | C#CCCC(C)N=[N+]=[N-] |
| InChI | InChI=1S/C6H9N3/c1-3-4-5-6(2)8-9-7/h1,6H,4-5H2,2H3 |
| InChIKey | KRZUJIKFRVLMGM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.16 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-azidohex-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-azidohex-1-yne?
The IUPAC name of 5-azidohex-1-yne (CID 89255941) is 5-azidohex-1-yne.
What is the SMILES notation for 5-azidohex-1-yne?
The canonical SMILES for 5-azidohex-1-yne is C#CCCC(C)N=[N+]=[N-].
What is the InChIKey of 5-azidohex-1-yne?
The InChIKey is KRZUJIKFRVLMGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3/c1-3-4-5-6(2)8-9-7/h1,6H,4-5H2,2H3.
What are the key properties of 5-azidohex-1-yne?
5-azidohex-1-yne has a molecular weight of 123.16 g/mol, XLogP of 2.10, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-azidohex-1-yne is sourced from PubChem (CID 89255941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).