C32H36O4 — CID 58069077
(E)-3-(4-ethoxyphenyl)-1-[4-[[4-(4-ethylcyclohexyl)phenyl]-hydroperoxymethyl]phenyl]prop-2-en-1-one (PubChem CID 58069077) has the molecular formula C32H36O4 and a molecular weight of 484.64 g/mol. Its IUPAC name is (E)-3-(4-ethoxyphenyl)-1-[4-[[4-(4-ethylcyclohexyl)phenyl]-hydroperoxymethyl]phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-ethoxyphenyl)-1-[4-[[4-(4-ethylcyclohexyl)phenyl]-hydroperoxymethyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 58069077 |
| Molecular Formula | C32H36O4 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | (E)-3-(4-ethoxyphenyl)-1-[4-[[4-(4-ethylcyclohexyl)phenyl]-hydroperoxymethyl]phenyl]prop-2-en-1-one |
| SMILES | CCOc1ccc(/C=C/C(=O)c2ccc(C(OO)c3ccc(C4CCC(CC)CC4)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H36O4/c1-3-23-5-10-25(11-6-23)26-12-16-28(17-13-26)32(36-34)29-18-14-27(15-19-29)31(33)22-9-24-7-20-30(21-8-24)35-4-2/h7-9,12-23,25,32,34H,3-6,10-11H2,1-2H3/b22-9+ |
| InChIKey | DSKOSZHDQSHDEZ-LSFURLLWSA-N |
| XLogP | 8.24 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|