C21H23F3O2 — CID 121324107
5-[[4-(4-ethylcyclohexyl)phenyl]-hydroperoxymethyl]-1,2,3-trifluorobenzene (PubChem CID 121324107) has the molecular formula C21H23F3O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is 5-[[4-(4-ethylcyclohexyl)phenyl]-hydroperoxymethyl]-1,2,3-trifluorobenzene.
| Compound Name | 5-[[4-(4-ethylcyclohexyl)phenyl]-hydroperoxymethyl]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 121324107 |
| Molecular Formula | C21H23F3O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 5-[[4-(4-ethylcyclohexyl)phenyl]-hydroperoxymethyl]-1,2,3-trifluorobenzene |
| SMILES | CCC1CCC(c2ccc(C(OO)c3cc(F)c(F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C21H23F3O2/c1-2-13-3-5-14(6-4-13)15-7-9-16(10-8-15)21(26-25)17-11-18(22)20(24)19(23)12-17/h7-14,21,25H,2-6H2,1H3 |
| InChIKey | GCCVIIRFOXZQRA-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|