C25H32FN4O7P — CID 58069376
propan-2-yl (2R)-2-[[[(2R,3R,4R,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-4-fluoro-3-hydroxy-5-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 58069376) has the molecular formula C25H32FN4O7P and a molecular weight of 550.52 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[[(2R,3R,4R,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-4-fluoro-3-hydroxy-5-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[[(2R,3R,4R,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-4-fluoro-3-hydroxy-5-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 58069376 |
| Molecular Formula | C25H32FN4O7P |
| Molecular Weight | 550.52 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | propan-2-yl (2R)-2-[[[(2R,3R,4R,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-4-fluoro-3-hydroxy-5-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@@H](C)NP(=O)(OC[C@H]1O[C@@](C)(c2ccc3c(N)ccnn23)[C@H](F)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C25H32FN4O7P/c1-15(2)35-24(32)16(3)29-38(33,37-17-8-6-5-7-9-17)34-14-20-22(31)23(26)25(4,36-20)21-11-10-19-18(27)12-13-28-30(19)21/h5-13,15-16,20,22-23,31H,14,27H2,1-4H3,(H,29,33)/t16-,20-,22-,23-,25+,38?/m1/s1 |
| InChIKey | GCRZUZVYLNUEMC-RCNUEWADSA-N |
| XLogP | 3.36 |
| TPSA | 146.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|