C27H27ClFNO5 — CID 58070856
[(1S,2S,6R,7R)-4-[4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]-2,6-dimethylphenyl]-5-oxo-10-oxatricyclo[5.2.1.02,6]dec-3-en-3-yl] 2,2-dimethylpropanoate (PubChem CID 58070856) has the molecular formula C27H27ClFNO5 and a molecular weight of 499.97 g/mol. Its IUPAC name is [(1S,2S,6R,7R)-4-[4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]-2,6-dimethylphenyl]-5-oxo-10-oxatricyclo[5.2.1.02,6]dec-3-en-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [(1S,2S,6R,7R)-4-[4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]-2,6-dimethylphenyl]-5-oxo-10-oxatricyclo[5.2.1.02,6]dec-3-en-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 58070856 |
| Molecular Formula | C27H27ClFNO5 |
| Molecular Weight | 499.97 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | [(1S,2S,6R,7R)-4-[4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]-2,6-dimethylphenyl]-5-oxo-10-oxatricyclo[5.2.1.02,6]dec-3-en-3-yl] 2,2-dimethylpropanoate |
| SMILES | Cc1cc(Oc2ncc(Cl)cc2F)cc(C)c1C1=C(OC(=O)C(C)(C)C)[C@H]2[C@@H](C1=O)[C@H]1CC[C@@H]2O1 |
| InChI | InChI=1S/C27H27ClFNO5/c1-12-8-15(33-25-16(29)10-14(28)11-30-25)9-13(2)19(12)22-23(31)20-17-6-7-18(34-17)21(20)24(22)35-26(32)27(3,4)5/h8-11,17-18,20-21H,6-7H2,1-5H3/t17-,18+,20+,21-/m1/s1 |
| InChIKey | ODAJGCSCRPKPFW-YXYSEUPNSA-N |
| XLogP | 5.96 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.97 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |