C29H31FO5 — CID 90083983
[(1R,2S,6R,7S)-4-[4-(2-fluoro-4-methylphenoxy)-2,6-dimethylphenyl]-5-oxo-10-oxatricyclo[5.2.1.02,6]dec-3-en-3-yl] 2,2-dimethylpropanoate (PubChem CID 90083983) has the molecular formula C29H31FO5 and a molecular weight of 478.56 g/mol. Its IUPAC name is [(1R,2S,6R,7S)-4-[4-(2-fluoro-4-methylphenoxy)-2,6-dimethylphenyl]-5-oxo-10-oxatricyclo[5.2.1.02,6]dec-3-en-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [(1R,2S,6R,7S)-4-[4-(2-fluoro-4-methylphenoxy)-2,6-dimethylphenyl]-5-oxo-10-oxatricyclo[5.2.1.02,6]dec-3-en-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 90083983 |
| Molecular Formula | C29H31FO5 |
| Molecular Weight | 478.56 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | [(1R,2S,6R,7S)-4-[4-(2-fluoro-4-methylphenoxy)-2,6-dimethylphenyl]-5-oxo-10-oxatricyclo[5.2.1.02,6]dec-3-en-3-yl] 2,2-dimethylpropanoate |
| SMILES | Cc1ccc(Oc2cc(C)c(C3=C(OC(=O)C(C)(C)C)[C@H]4[C@@H](C3=O)[C@@H]3CC[C@H]4O3)c(C)c2)c(F)c1 |
| InChI | InChI=1S/C29H31FO5/c1-14-7-8-19(18(30)11-14)33-17-12-15(2)22(16(3)13-17)25-26(31)23-20-9-10-21(34-20)24(23)27(25)35-28(32)29(4,5)6/h7-8,11-13,20-21,23-24H,9-10H2,1-6H3/t20-,21+,23-,24+/m0/s1 |
| InChIKey | QXXBQQRJGZVUJD-SGKWCMOWSA-N |
| XLogP | 6.22 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.56 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |