C22H20N2O6 — CID 51428254
(3aS,4R,7S,7aR)-2-[3-(2,5-dimethylphenoxy)-5-nitrophenyl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 51428254) has the molecular formula C22H20N2O6 and a molecular weight of 408.41 g/mol. Its IUPAC name is (3aS,4R,7S,7aR)-2-[3-(2,5-dimethylphenoxy)-5-nitrophenyl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aS,4R,7S,7aR)-2-[3-(2,5-dimethylphenoxy)-5-nitrophenyl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 51428254 |
| Molecular Formula | C22H20N2O6 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | (3aS,4R,7S,7aR)-2-[3-(2,5-dimethylphenoxy)-5-nitrophenyl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | Cc1ccc(C)c(Oc2cc(N3C(=O)[C@@H]4[C@H](C3=O)[C@H]3CC[C@@H]4O3)cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C22H20N2O6/c1-11-3-4-12(2)18(7-11)29-15-9-13(8-14(10-15)24(27)28)23-21(25)19-16-5-6-17(30-16)20(19)22(23)26/h3-4,7-10,16-17,19-20H,5-6H2,1-2H3/t16-,17+,19-,20+ |
| InChIKey | CZYFRFJXXXEKSW-TZRIAGMCSA-N |
| XLogP | 3.67 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|