C17H15N3O6 — CID 87491738
(1S,2S,6R,7R,8S,10R)-4-(3,5-dinitrophenyl)-4-azatetracyclo[5.3.2.02,6.08,10]dodecane-3,5-dione (PubChem CID 87491738) has the molecular formula C17H15N3O6 and a molecular weight of 357.32 g/mol. Its IUPAC name is (1S,2S,6R,7R,8S,10R)-4-(3,5-dinitrophenyl)-4-azatetracyclo[5.3.2.02,6.08,10]dodecane-3,5-dione.
| Compound Name | (1S,2S,6R,7R,8S,10R)-4-(3,5-dinitrophenyl)-4-azatetracyclo[5.3.2.02,6.08,10]dodecane-3,5-dione |
|---|---|
| PubChem CID | 87491738 |
| Molecular Formula | C17H15N3O6 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | (1S,2S,6R,7R,8S,10R)-4-(3,5-dinitrophenyl)-4-azatetracyclo[5.3.2.02,6.08,10]dodecane-3,5-dione |
| SMILES | O=C1[C@@H]2[C@@H]3CC[C@@H]([C@@H]4C[C@@H]43)[C@@H]2C(=O)N1c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H15N3O6/c21-16-14-10-1-2-11(13-6-12(10)13)15(14)17(22)18(16)7-3-8(19(23)24)5-9(4-7)20(25)26/h3-5,10-15H,1-2,6H2/t10-,11+,12-,13+,14-,15+ |
| InChIKey | SVFGMYZDVDVQLS-KRXYVZHUSA-N |
| XLogP | 2.28 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|