C17H15Br2NO2 — CID 68544946
(1S,2S,6R,7R,8S,10R)-4-(3,5-dibromophenyl)-4-azatetracyclo[5.3.2.02,6.08,10]dodecane-3,5-dione (PubChem CID 68544946) has the molecular formula C17H15Br2NO2 and a molecular weight of 425.12 g/mol. Its IUPAC name is (1S,2S,6R,7R,8S,10R)-4-(3,5-dibromophenyl)-4-azatetracyclo[5.3.2.02,6.08,10]dodecane-3,5-dione.
| Compound Name | (1S,2S,6R,7R,8S,10R)-4-(3,5-dibromophenyl)-4-azatetracyclo[5.3.2.02,6.08,10]dodecane-3,5-dione |
|---|---|
| PubChem CID | 68544946 |
| Molecular Formula | C17H15Br2NO2 |
| Molecular Weight | 425.12 g/mol |
| Exact Mass | 422.95 |
| IUPAC Name | (1S,2S,6R,7R,8S,10R)-4-(3,5-dibromophenyl)-4-azatetracyclo[5.3.2.02,6.08,10]dodecane-3,5-dione |
| SMILES | O=C1[C@@H]2[C@@H]3CC[C@@H]([C@@H]4C[C@@H]43)[C@@H]2C(=O)N1c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C17H15Br2NO2/c18-7-3-8(19)5-9(4-7)20-16(21)14-10-1-2-11(13-6-12(10)13)15(14)17(20)22/h3-5,10-15H,1-2,6H2/t10-,11+,12-,13+,14-,15+ |
| InChIKey | MMABPYVPBUIVSX-KRXYVZHUSA-N |
| XLogP | 3.99 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.12 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|