C25H28N5O2P — CID 58071452
N-[4-(4-amino-1-oxo-1λ5-phosphinan-1-yl)-2-methoxyphenyl]-4-(1H-indol-3-yl)-5-methylpyrimidin-2-amine (PubChem CID 58071452) has the molecular formula C25H28N5O2P and a molecular weight of 461.51 g/mol. Its IUPAC name is N-[4-(4-amino-1-oxo-1λ5-phosphinan-1-yl)-2-methoxyphenyl]-4-(1H-indol-3-yl)-5-methylpyrimidin-2-amine.
| Compound Name | N-[4-(4-amino-1-oxo-1λ5-phosphinan-1-yl)-2-methoxyphenyl]-4-(1H-indol-3-yl)-5-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 58071452 |
| Molecular Formula | C25H28N5O2P |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | N-[4-(4-amino-1-oxo-1λ5-phosphinan-1-yl)-2-methoxyphenyl]-4-(1H-indol-3-yl)-5-methylpyrimidin-2-amine |
| SMILES | COc1cc(P2(=O)CCC(N)CC2)ccc1Nc1ncc(C)c(-c2c[nH]c3ccccc23)n1 |
| InChI | InChI=1S/C25H28N5O2P/c1-16-14-28-25(30-24(16)20-15-27-21-6-4-3-5-19(20)21)29-22-8-7-18(13-23(22)32-2)33(31)11-9-17(26)10-12-33/h3-8,13-15,17,27H,9-12,26H2,1-2H3,(H,28,29,30) |
| InChIKey | VPCCHIABSWRMCS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|