About 3-methoxy-9,9a-dihydro-4aH-carbazole
3-methoxy-9,9a-dihydro-4aH-carbazole (PubChem CID 58078019) has the molecular formula C13H13NO
and a molecular weight of 199.25 g/mol. Its IUPAC name is 3-methoxy-9,9a-dihydro-4aH-carbazole.
Molecular Properties
| Compound Name | 3-methoxy-9,9a-dihydro-4aH-carbazole |
| PubChem CID | 58078019 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 3-methoxy-9,9a-dihydro-4aH-carbazole |
| SMILES | COC1=CC2c3ccccc3NC2C=C1 |
| InChI | InChI=1S/C13H13NO/c1-15-9-6-7-13-11(8-9)10-4-2-3-5-12(10)14-13/h2-8,11,13-14H,1H3 |
| InChIKey | YCFJZJULNGAYOH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methoxy-9,9a-dihydro-4aH-carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-9,9a-dihydro-4aH-carbazole?
The IUPAC name of 3-methoxy-9,9a-dihydro-4aH-carbazole (CID 58078019) is 3-methoxy-9,9a-dihydro-4aH-carbazole.
What is the SMILES notation for 3-methoxy-9,9a-dihydro-4aH-carbazole?
The canonical SMILES for 3-methoxy-9,9a-dihydro-4aH-carbazole is COC1=CC2c3ccccc3NC2C=C1.
What is the InChIKey of 3-methoxy-9,9a-dihydro-4aH-carbazole?
The InChIKey is YCFJZJULNGAYOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO/c1-15-9-6-7-13-11(8-9)10-4-2-3-5-12(10)14-13/h2-8,11,13-14H,1H3.
What are the key properties of 3-methoxy-9,9a-dihydro-4aH-carbazole?
3-methoxy-9,9a-dihydro-4aH-carbazole has a molecular weight of 199.25 g/mol, XLogP of 2.66, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-9,9a-dihydro-4aH-carbazole is sourced from PubChem (CID 58078019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).