C23H24N4O — CID 58078619
(3R,4R)-3-(3,8-diazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)-4-methyl-N-phenylpiperidine-1-carboxamide (PubChem CID 58078619) has the molecular formula C23H24N4O and a molecular weight of 372.47 g/mol. Its IUPAC name is (3R,4R)-3-(3,8-diazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)-4-methyl-N-phenylpiperidine-1-carboxamide.
| Compound Name | (3R,4R)-3-(3,8-diazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)-4-methyl-N-phenylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 58078619 |
| Molecular Formula | C23H24N4O |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | (3R,4R)-3-(3,8-diazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)-4-methyl-N-phenylpiperidine-1-carboxamide |
| SMILES | C[C@@H]1CCN(C(=O)Nc2ccccc2)C[C@@H]1n1ccc2cnc3c(c21)C=CC3 |
| InChI | InChI=1S/C23H24N4O/c1-16-10-12-26(23(28)25-18-6-3-2-4-7-18)15-21(16)27-13-11-17-14-24-20-9-5-8-19(20)22(17)27/h2-8,11,13-14,16,21H,9-10,12,15H2,1H3,(H,25,28)/t16-,21+/m1/s1 |
| InChIKey | OEONHBKZOCCPGP-IERDGZPVSA-N |
| XLogP | 4.72 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |