C7H12N2 — CID 58082056
(3E)-3-methylhexa-3,5-dienimidamide (PubChem CID 58082056) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is (3E)-3-methylhexa-3,5-dienimidamide.
| Compound Name | (3E)-3-methylhexa-3,5-dienimidamide |
|---|---|
| PubChem CID | 58082056 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | (3E)-3-methylhexa-3,5-dienimidamide |
| SMILES | [H]/N=C(\N)C/C(C)=C/C=C |
| InChI | InChI=1S/C7H12N2/c1-3-4-6(2)5-7(8)9/h3-4H,1,5H2,2H3,(H3,8,9)/b6-4+ |
| InChIKey | SKZDGQBGYBOCON-GQCTYLIASA-N |
| XLogP | 1.44 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|