About hex-3-enimidamide
hex-3-enimidamide (PubChem CID 57196822) has the molecular formula C6H12N2
and a molecular weight of 112.18 g/mol. Its IUPAC name is hex-3-enimidamide.
Molecular Properties
| Compound Name | hex-3-enimidamide |
| PubChem CID | 57196822 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | hex-3-enimidamide |
| SMILES | [H]/N=C(/N)CC=CCC |
| InChI | InChI=1S/C6H12N2/c1-2-3-4-5-6(7)8/h3-4H,2,5H2,1H3,(H3,7,8) |
| InChIKey | BFDUOKPQDRKBDX-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze hex-3-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hex-3-enimidamide?
The IUPAC name of hex-3-enimidamide (CID 57196822) is hex-3-enimidamide.
What is the SMILES notation for hex-3-enimidamide?
The canonical SMILES for hex-3-enimidamide is [H]/N=C(/N)CC=CCC.
What is the InChIKey of hex-3-enimidamide?
The InChIKey is BFDUOKPQDRKBDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2/c1-2-3-4-5-6(7)8/h3-4H,2,5H2,1H3,(H3,7,8).
What are the key properties of hex-3-enimidamide?
hex-3-enimidamide has a molecular weight of 112.18 g/mol, XLogP of 1.28, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hex-3-enimidamide is sourced from PubChem (CID 57196822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).