C13H10ClN3 — CID 58087153
N-(4-chlorophenyl)-1H-pyrrolo[2,3-b]pyridin-3-amine (PubChem CID 58087153) has the molecular formula C13H10ClN3 and a molecular weight of 243.70 g/mol. Its IUPAC name is N-(4-chlorophenyl)-1H-pyrrolo[2,3-b]pyridin-3-amine.
| Compound Name | N-(4-chlorophenyl)-1H-pyrrolo[2,3-b]pyridin-3-amine |
|---|---|
| PubChem CID | 58087153 |
| Molecular Formula | C13H10ClN3 |
| Molecular Weight | 243.70 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | N-(4-chlorophenyl)-1H-pyrrolo[2,3-b]pyridin-3-amine |
| SMILES | Clc1ccc(Nc2c[nH]c3ncccc23)cc1 |
| InChI | InChI=1S/C13H10ClN3/c14-9-3-5-10(6-4-9)17-12-8-16-13-11(12)2-1-7-15-13/h1-8,17H,(H,15,16) |
| InChIKey | KKUFAKPOIZWDBS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.70 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |