C8H8N4O — CID 174976610
N-(1H-pyrrolo[2,3-b]pyridin-3-ylamino)formamide (PubChem CID 174976610) has the molecular formula C8H8N4O and a molecular weight of 176.18 g/mol. Its IUPAC name is N-(1H-pyrrolo[2,3-b]pyridin-3-ylamino)formamide.
| Compound Name | N-(1H-pyrrolo[2,3-b]pyridin-3-ylamino)formamide |
|---|---|
| PubChem CID | 174976610 |
| Molecular Formula | C8H8N4O |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | N-(1H-pyrrolo[2,3-b]pyridin-3-ylamino)formamide |
| SMILES | O=CNNc1c[nH]c2ncccc12 |
| InChI | InChI=1S/C8H8N4O/c13-5-11-12-7-4-10-8-6(7)2-1-3-9-8/h1-5,12H,(H,9,10)(H,11,13) |
| InChIKey | PCMJHBVHWPVNOR-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|