C21H11Cl2N5S2 — CID 58097280
6-chloro-2-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-5-isocyano-4-(2H-pyrrol-5-yl)pyridine-3-carbonitrile (PubChem CID 58097280) has the molecular formula C21H11Cl2N5S2 and a molecular weight of 468.39 g/mol. Its IUPAC name is 6-chloro-2-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-5-isocyano-4-(2H-pyrrol-5-yl)pyridine-3-carbonitrile.
| Compound Name | 6-chloro-2-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-5-isocyano-4-(2H-pyrrol-5-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 58097280 |
| Molecular Formula | C21H11Cl2N5S2 |
| Molecular Weight | 468.39 g/mol |
| Exact Mass | 466.98 |
| IUPAC Name | 6-chloro-2-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-5-isocyano-4-(2H-pyrrol-5-yl)pyridine-3-carbonitrile |
| SMILES | [C-]#[N+]c1c(Cl)nc(SCc2csc(-c3ccc(Cl)cc3)n2)c(C#N)c1C1=NCC=C1 |
| InChI | InChI=1S/C21H11Cl2N5S2/c1-25-18-17(16-3-2-8-26-16)15(9-24)21(28-19(18)23)30-11-14-10-29-20(27-14)12-4-6-13(22)7-5-12/h2-7,10H,8,11H2 |
| InChIKey | VHNBQWGWIWMSMY-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 66.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.39 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|