C31H38FN3O2 — CID 58098160
N-[[(1R,2R)-2-[[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]methyl]cyclohexyl]methyl]-1,2,3,4-tetrahydronaphthalene-2-carboxamide (PubChem CID 58098160) has the molecular formula C31H38FN3O2 and a molecular weight of 503.66 g/mol. Its IUPAC name is N-[[(1R,2R)-2-[[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]methyl]cyclohexyl]methyl]-1,2,3,4-tetrahydronaphthalene-2-carboxamide.
| Compound Name | N-[[(1R,2R)-2-[[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]methyl]cyclohexyl]methyl]-1,2,3,4-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 58098160 |
| Molecular Formula | C31H38FN3O2 |
| Molecular Weight | 503.66 g/mol |
| Exact Mass | 503.29 |
| IUPAC Name | N-[[(1R,2R)-2-[[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]methyl]cyclohexyl]methyl]-1,2,3,4-tetrahydronaphthalene-2-carboxamide |
| SMILES | O=C(NC[C@@H]1CCCC[C@H]1CN1CCC(c2noc3cc(F)ccc23)CC1)C1CCc2ccccc2C1 |
| InChI | InChI=1S/C31H38FN3O2/c32-27-11-12-28-29(18-27)37-34-30(28)22-13-15-35(16-14-22)20-26-8-4-3-7-25(26)19-33-31(36)24-10-9-21-5-1-2-6-23(21)17-24/h1-2,5-6,11-12,18,22,24-26H,3-4,7-10,13-17,19-20H2,(H,33,36)/t24?,25-,26-/m0/s1 |
| InChIKey | IAQVUXNJLUFROV-WIXBZOCESA-N |
| XLogP | 5.87 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.66 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |