About 3-aminobutyl formate
3-aminobutyl formate (PubChem CID 58098450) has the molecular formula C5H11NO2
and a molecular weight of 117.15 g/mol. Its IUPAC name is 3-aminobutyl formate.
Molecular Properties
| Compound Name | 3-aminobutyl formate |
| PubChem CID | 58098450 |
| Molecular Formula | C5H11NO2 |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.08 |
| IUPAC Name | 3-aminobutyl formate |
| SMILES | CC(N)CCOC=O |
| InChI | InChI=1S/C5H11NO2/c1-5(6)2-3-8-4-7/h4-5H,2-3,6H2,1H3 |
| InChIKey | UXEJPUZKDZDBQT-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-aminobutyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminobutyl formate?
The IUPAC name of 3-aminobutyl formate (CID 58098450) is 3-aminobutyl formate.
What is the SMILES notation for 3-aminobutyl formate?
The canonical SMILES for 3-aminobutyl formate is CC(N)CCOC=O.
What is the InChIKey of 3-aminobutyl formate?
The InChIKey is UXEJPUZKDZDBQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2/c1-5(6)2-3-8-4-7/h4-5H,2-3,6H2,1H3.
What are the key properties of 3-aminobutyl formate?
3-aminobutyl formate has a molecular weight of 117.15 g/mol, XLogP of -0.10, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminobutyl formate is sourced from PubChem (CID 58098450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).