C34H36N2O7S3 — CID 58100781
4-[[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]sulfanyl-(10-phenylacridin-9-ylidene)methyl]sulfanylbutane-1-sulfonic acid (PubChem CID 58100781) has the molecular formula C34H36N2O7S3 and a molecular weight of 680.87 g/mol. Its IUPAC name is 4-[[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]sulfanyl-(10-phenylacridin-9-ylidene)methyl]sulfanylbutane-1-sulfonic acid.
| Compound Name | 4-[[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]sulfanyl-(10-phenylacridin-9-ylidene)methyl]sulfanylbutane-1-sulfonic acid |
|---|---|
| PubChem CID | 58100781 |
| Molecular Formula | C34H36N2O7S3 |
| Molecular Weight | 680.87 g/mol |
| Exact Mass | 680.17 |
| IUPAC Name | 4-[[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]sulfanyl-(10-phenylacridin-9-ylidene)methyl]sulfanylbutane-1-sulfonic acid |
| SMILES | O=C(CCCCCSC(SCCCCS(=O)(=O)O)=C1c2ccccc2N(c2ccccc2)c2ccccc21)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C34H36N2O7S3/c37-30-20-21-31(38)36(30)43-32(39)19-5-2-10-22-44-34(45-23-11-12-24-46(40,41)42)33-26-15-6-8-17-28(26)35(25-13-3-1-4-14-25)29-18-9-7-16-27(29)33/h1,3-4,6-9,13-18H,2,5,10-12,19-24H2,(H,40,41,42) |
| InChIKey | YPSVDAYWHUTADM-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.87 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|