C17H19NO4 — CID 58102875
methyl (2E,4E)-5-(2,3-dihydro-1H-inden-1-ylamino)-2-(formyloxymethyl)penta-2,4-dienoate (PubChem CID 58102875) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is methyl (2E,4E)-5-(2,3-dihydro-1H-inden-1-ylamino)-2-(formyloxymethyl)penta-2,4-dienoate.
| Compound Name | methyl (2E,4E)-5-(2,3-dihydro-1H-inden-1-ylamino)-2-(formyloxymethyl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 58102875 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | methyl (2E,4E)-5-(2,3-dihydro-1H-inden-1-ylamino)-2-(formyloxymethyl)penta-2,4-dienoate |
| SMILES | COC(=O)/C(=C/C=C/NC1CCc2ccccc21)COC=O |
| InChI | InChI=1S/C17H19NO4/c1-21-17(20)14(11-22-12-19)6-4-10-18-16-9-8-13-5-2-3-7-15(13)16/h2-7,10,12,16,18H,8-9,11H2,1H3/b10-4+,14-6+ |
| InChIKey | POXXKQKHJYSSDH-MFKOMQOXSA-N |
| XLogP | 2.05 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|