C16H24O3Si — CID 582013
methyl 2-(2-trimethylsilyloxy-1,2,3,4-tetrahydronaphthalen-1-yl)acetate (PubChem CID 582013) has the molecular formula C16H24O3Si and a molecular weight of 292.45 g/mol. Its IUPAC name is methyl 2-(2-trimethylsilyloxy-1,2,3,4-tetrahydronaphthalen-1-yl)acetate.
| Compound Name | methyl 2-(2-trimethylsilyloxy-1,2,3,4-tetrahydronaphthalen-1-yl)acetate |
|---|---|
| PubChem CID | 582013 |
| Molecular Formula | C16H24O3Si |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | methyl 2-(2-trimethylsilyloxy-1,2,3,4-tetrahydronaphthalen-1-yl)acetate |
| SMILES | COC(=O)CC1c2ccccc2CCC1O[Si](C)(C)C |
| InChI | InChI=1S/C16H24O3Si/c1-18-16(17)11-14-13-8-6-5-7-12(13)9-10-15(14)19-20(2,3)4/h5-8,14-15H,9-11H2,1-4H3 |
| InChIKey | RZLKQOPOOKBFAC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|