C20H18Cl2FNO2 — CID 58109261
3-[(2,5-dichlorophenyl)methyl]-6-(4-fluorophenyl)-6-prop-2-enyl-1,3-oxazinan-2-one (PubChem CID 58109261) has the molecular formula C20H18Cl2FNO2 and a molecular weight of 394.27 g/mol. Its IUPAC name is 3-[(2,5-dichlorophenyl)methyl]-6-(4-fluorophenyl)-6-prop-2-enyl-1,3-oxazinan-2-one.
| Compound Name | 3-[(2,5-dichlorophenyl)methyl]-6-(4-fluorophenyl)-6-prop-2-enyl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 58109261 |
| Molecular Formula | C20H18Cl2FNO2 |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 3-[(2,5-dichlorophenyl)methyl]-6-(4-fluorophenyl)-6-prop-2-enyl-1,3-oxazinan-2-one |
| SMILES | C=CCC1(c2ccc(F)cc2)CCN(Cc2cc(Cl)ccc2Cl)C(=O)O1 |
| InChI | InChI=1S/C20H18Cl2FNO2/c1-2-9-20(15-3-6-17(23)7-4-15)10-11-24(19(25)26-20)13-14-12-16(21)5-8-18(14)22/h2-8,12H,1,9-11,13H2 |
| InChIKey | YIZVYRYMADLRBD-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|