About N-tert-butyl-1-cyclohexa-1,3-dien-1-ylbutan-2-amine
N-tert-butyl-1-cyclohexa-1,3-dien-1-ylbutan-2-amine (PubChem CID 58109916) has the molecular formula C14H25N
and a molecular weight of 207.36 g/mol. Its IUPAC name is N-tert-butyl-1-cyclohexa-1,3-dien-1-ylbutan-2-amine.
Molecular Properties
| Compound Name | N-tert-butyl-1-cyclohexa-1,3-dien-1-ylbutan-2-amine |
| PubChem CID | 58109916 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | N-tert-butyl-1-cyclohexa-1,3-dien-1-ylbutan-2-amine |
| SMILES | CCC(CC1=CC=CCC1)NC(C)(C)C |
| InChI | InChI=1S/C14H25N/c1-5-13(15-14(2,3)4)11-12-9-7-6-8-10-12/h6-7,9,13,15H,5,8,10-11H2,1-4H3 |
| InChIKey | AGMAISKKJGPJSG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-tert-butyl-1-cyclohexa-1,3-dien-1-ylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-1-cyclohexa-1,3-dien-1-ylbutan-2-amine?
The IUPAC name of N-tert-butyl-1-cyclohexa-1,3-dien-1-ylbutan-2-amine (CID 58109916) is N-tert-butyl-1-cyclohexa-1,3-dien-1-ylbutan-2-amine.
What is the SMILES notation for N-tert-butyl-1-cyclohexa-1,3-dien-1-ylbutan-2-amine?
The canonical SMILES for N-tert-butyl-1-cyclohexa-1,3-dien-1-ylbutan-2-amine is CCC(CC1=CC=CCC1)NC(C)(C)C.
What is the InChIKey of N-tert-butyl-1-cyclohexa-1,3-dien-1-ylbutan-2-amine?
The InChIKey is AGMAISKKJGPJSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N/c1-5-13(15-14(2,3)4)11-12-9-7-6-8-10-12/h6-7,9,13,15H,5,8,10-11H2,1-4H3.
What are the key properties of N-tert-butyl-1-cyclohexa-1,3-dien-1-ylbutan-2-amine?
N-tert-butyl-1-cyclohexa-1,3-dien-1-ylbutan-2-amine has a molecular weight of 207.36 g/mol, XLogP of 3.82, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-1-cyclohexa-1,3-dien-1-ylbutan-2-amine is sourced from PubChem (CID 58109916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).