C23H21F4N7O — CID 58109981
N-[3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-9-[4-(trifluoromethoxy)phenyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine (PubChem CID 58109981) has the molecular formula C23H21F4N7O and a molecular weight of 487.46 g/mol. Its IUPAC name is N-[3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-9-[4-(trifluoromethoxy)phenyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine.
| Compound Name | N-[3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-9-[4-(trifluoromethoxy)phenyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine |
|---|---|
| PubChem CID | 58109981 |
| Molecular Formula | C23H21F4N7O |
| Molecular Weight | 487.46 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | N-[3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-9-[4-(trifluoromethoxy)phenyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine |
| SMILES | Cc1ncn(-c2ccc(Nc3nc4n(n3)CCCCC4c3ccc(OC(F)(F)F)cc3)cc2F)n1 |
| InChI | InChI=1S/C23H21F4N7O/c1-14-28-13-34(31-14)20-10-7-16(12-19(20)24)29-22-30-21-18(4-2-3-11-33(21)32-22)15-5-8-17(9-6-15)35-23(25,26)27/h5-10,12-13,18H,2-4,11H2,1H3,(H,29,32) |
| InChIKey | YVPHOYSDZMKDTF-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.46 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |