C18H26N4O3S2 — CID 58112146
tert-butyl N-[2-[5-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]thiophen-2-yl]ethylcarbamoylamino]carbamate (PubChem CID 58112146) has the molecular formula C18H26N4O3S2 and a molecular weight of 410.57 g/mol. Its IUPAC name is tert-butyl N-[2-[5-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]thiophen-2-yl]ethylcarbamoylamino]carbamate.
| Compound Name | tert-butyl N-[2-[5-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]thiophen-2-yl]ethylcarbamoylamino]carbamate |
|---|---|
| PubChem CID | 58112146 |
| Molecular Formula | C18H26N4O3S2 |
| Molecular Weight | 410.57 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | tert-butyl N-[2-[5-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]thiophen-2-yl]ethylcarbamoylamino]carbamate |
| SMILES | Cc1nc(CCc2ccc(CCNC(=O)NNC(=O)OC(C)(C)C)s2)cs1 |
| InChI | InChI=1S/C18H26N4O3S2/c1-12-20-13(11-26-12)5-6-14-7-8-15(27-14)9-10-19-16(23)21-22-17(24)25-18(2,3)4/h7-8,11H,5-6,9-10H2,1-4H3,(H,22,24)(H2,19,21,23) |
| InChIKey | XJGCLUYCFXSLHG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.57 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|