C21H24O5 — CID 58112239
3-(hydroxymethyl)-1,8-dipropoxy-4a,9a-dihydroanthracene-9,10-dione (PubChem CID 58112239) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is 3-(hydroxymethyl)-1,8-dipropoxy-4a,9a-dihydroanthracene-9,10-dione.
| Compound Name | 3-(hydroxymethyl)-1,8-dipropoxy-4a,9a-dihydroanthracene-9,10-dione |
|---|---|
| PubChem CID | 58112239 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 3-(hydroxymethyl)-1,8-dipropoxy-4a,9a-dihydroanthracene-9,10-dione |
| SMILES | CCCOC1=CC(CO)=CC2C(=O)c3cccc(OCCC)c3C(=O)C12 |
| InChI | InChI=1S/C21H24O5/c1-3-8-25-16-7-5-6-14-18(16)21(24)19-15(20(14)23)10-13(12-22)11-17(19)26-9-4-2/h5-7,10-11,15,19,22H,3-4,8-9,12H2,1-2H3 |
| InChIKey | AEAIJJYBVHEAFH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|