C15H16NO2S+ — CID 58113594
4,6-dimethylspiro[1,3-dioxane-2,4'-thieno[2,3-a]indolizin-5-ium] (PubChem CID 58113594) has the molecular formula C15H16NO2S+ and a molecular weight of 274.36 g/mol. Its IUPAC name is 4,6-dimethylspiro[1,3-dioxane-2,4'-thieno[2,3-a]indolizin-5-ium].
| Compound Name | 4,6-dimethylspiro[1,3-dioxane-2,4'-thieno[2,3-a]indolizin-5-ium] |
|---|---|
| PubChem CID | 58113594 |
| Molecular Formula | C15H16NO2S+ |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 4,6-dimethylspiro[1,3-dioxane-2,4'-thieno[2,3-a]indolizin-5-ium] |
| SMILES | CC1CC(C)OC2(O1)c1ccsc1-c1cccc[n+]12 |
| InChI | InChI=1S/C15H16NO2S/c1-10-9-11(2)18-15(17-10)12-6-8-19-14(12)13-5-3-4-7-16(13)15/h3-8,10-11H,9H2,1-2H3/q+1 |
| InChIKey | JAVGVWZGBHBWOE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|