C21H23NO7S — CID 138964325
[(2R,3S,4R,6S)-3,4-diacetyloxy-6-(2-pyridin-2-ylthiophen-3-yl)oxan-2-yl]methyl acetate (PubChem CID 138964325) has the molecular formula C21H23NO7S and a molecular weight of 433.48 g/mol. Its IUPAC name is [(2R,3S,4R,6S)-3,4-diacetyloxy-6-(2-pyridin-2-ylthiophen-3-yl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,6S)-3,4-diacetyloxy-6-(2-pyridin-2-ylthiophen-3-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 138964325 |
| Molecular Formula | C21H23NO7S |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | [(2R,3S,4R,6S)-3,4-diacetyloxy-6-(2-pyridin-2-ylthiophen-3-yl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](c2ccsc2-c2ccccn2)C[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H23NO7S/c1-12(23)26-11-19-20(28-14(3)25)18(27-13(2)24)10-17(29-19)15-7-9-30-21(15)16-6-4-5-8-22-16/h4-9,17-20H,10-11H2,1-3H3/t17-,18+,19+,20-/m0/s1 |
| InChIKey | PQNKNVREGUSDJZ-NMLBUPMWSA-N |
| XLogP | 3.07 |
| TPSA | 101.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|