C30H29ClFNO9S — CID 66608293
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[[5-(5-fluoro-2-pyridinyl)thiophen-2-yl]methyl]phenyl]oxan-2-yl]methyl acetate (PubChem CID 66608293) has the molecular formula C30H29ClFNO9S and a molecular weight of 634.08 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[[5-(5-fluoro-2-pyridinyl)thiophen-2-yl]methyl]phenyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[[5-(5-fluoro-2-pyridinyl)thiophen-2-yl]methyl]phenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 66608293 |
| Molecular Formula | C30H29ClFNO9S |
| Molecular Weight | 634.08 g/mol |
| Exact Mass | 633.12 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[[5-(5-fluoro-2-pyridinyl)thiophen-2-yl]methyl]phenyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ccc(-c4ccc(F)cn4)s3)c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C30H29ClFNO9S/c1-15(34)38-14-25-28(39-16(2)35)30(41-18(4)37)29(40-17(3)36)27(42-25)19-5-8-23(31)20(11-19)12-22-7-10-26(43-22)24-9-6-21(32)13-33-24/h5-11,13,25,27-30H,12,14H2,1-4H3/t25-,27+,28-,29+,30+/m1/s1 |
| InChIKey | KZEIFZXXKQPAGK-JURZQKOZSA-N |
| XLogP | 4.99 |
| TPSA | 127.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.08 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|