C26H45N3O4S — CID 58116444
N-[4-[4-[4-(dimethylamino)butylamino]cyclohexyl]-3-oxobutyl]-4-methoxy-N,2,6-trimethylbenzenesulfonamide (PubChem CID 58116444) has the molecular formula C26H45N3O4S and a molecular weight of 495.73 g/mol. Its IUPAC name is N-[4-[4-[4-(dimethylamino)butylamino]cyclohexyl]-3-oxobutyl]-4-methoxy-N,2,6-trimethylbenzenesulfonamide.
| Compound Name | N-[4-[4-[4-(dimethylamino)butylamino]cyclohexyl]-3-oxobutyl]-4-methoxy-N,2,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 58116444 |
| Molecular Formula | C26H45N3O4S |
| Molecular Weight | 495.73 g/mol |
| Exact Mass | 495.31 |
| IUPAC Name | N-[4-[4-[4-(dimethylamino)butylamino]cyclohexyl]-3-oxobutyl]-4-methoxy-N,2,6-trimethylbenzenesulfonamide |
| SMILES | COc1cc(C)c(S(=O)(=O)N(C)CCC(=O)CC2CCC(NCCCCN(C)C)CC2)c(C)c1 |
| InChI | InChI=1S/C26H45N3O4S/c1-20-17-25(33-6)18-21(2)26(20)34(31,32)29(5)16-13-24(30)19-22-9-11-23(12-10-22)27-14-7-8-15-28(3)4/h17-18,22-23,27H,7-16,19H2,1-6H3 |
| InChIKey | GFXQITRHHZYNOJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.73 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|