C33H38F3N3O4 — CID 58118257
2-[4-[3-methyl-4-(trifluoromethoxy)anilino]cyclohexyl]oxy-1-[4-(4-phenylmethoxyphenyl)piperazin-1-yl]ethanone (PubChem CID 58118257) has the molecular formula C33H38F3N3O4 and a molecular weight of 597.68 g/mol. Its IUPAC name is 2-[4-[3-methyl-4-(trifluoromethoxy)anilino]cyclohexyl]oxy-1-[4-(4-phenylmethoxyphenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[4-[3-methyl-4-(trifluoromethoxy)anilino]cyclohexyl]oxy-1-[4-(4-phenylmethoxyphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 58118257 |
| Molecular Formula | C33H38F3N3O4 |
| Molecular Weight | 597.68 g/mol |
| Exact Mass | 597.28 |
| IUPAC Name | 2-[4-[3-methyl-4-(trifluoromethoxy)anilino]cyclohexyl]oxy-1-[4-(4-phenylmethoxyphenyl)piperazin-1-yl]ethanone |
| SMILES | Cc1cc(NC2CCC(OCC(=O)N3CCN(c4ccc(OCc5ccccc5)cc4)CC3)CC2)ccc1OC(F)(F)F |
| InChI | InChI=1S/C33H38F3N3O4/c1-24-21-27(9-16-31(24)43-33(34,35)36)37-26-7-12-29(13-8-26)42-23-32(40)39-19-17-38(18-20-39)28-10-14-30(15-11-28)41-22-25-5-3-2-4-6-25/h2-6,9-11,14-16,21,26,29,37H,7-8,12-13,17-20,22-23H2,1H3 |
| InChIKey | QPFMRVWAVWYRHA-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.68 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|