C31H41N5O5 — CID 58118275
2-methyl-4-[[4-[2-[4-[3-(2-methylpropoxy)-4-nitroanilino]piperidin-1-yl]-2-oxoethoxy]cyclohexyl]amino]benzonitrile (PubChem CID 58118275) has the molecular formula C31H41N5O5 and a molecular weight of 563.70 g/mol. Its IUPAC name is 2-methyl-4-[[4-[2-[4-[3-(2-methylpropoxy)-4-nitroanilino]piperidin-1-yl]-2-oxoethoxy]cyclohexyl]amino]benzonitrile.
| Compound Name | 2-methyl-4-[[4-[2-[4-[3-(2-methylpropoxy)-4-nitroanilino]piperidin-1-yl]-2-oxoethoxy]cyclohexyl]amino]benzonitrile |
|---|---|
| PubChem CID | 58118275 |
| Molecular Formula | C31H41N5O5 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.31 |
| IUPAC Name | 2-methyl-4-[[4-[2-[4-[3-(2-methylpropoxy)-4-nitroanilino]piperidin-1-yl]-2-oxoethoxy]cyclohexyl]amino]benzonitrile |
| SMILES | Cc1cc(NC2CCC(OCC(=O)N3CCC(Nc4ccc([N+](=O)[O-])c(OCC(C)C)c4)CC3)CC2)ccc1C#N |
| InChI | InChI=1S/C31H41N5O5/c1-21(2)19-41-30-17-27(8-11-29(30)36(38)39)34-25-12-14-35(15-13-25)31(37)20-40-28-9-6-24(7-10-28)33-26-5-4-23(18-32)22(3)16-26/h4-5,8,11,16-17,21,24-25,28,33-34H,6-7,9-10,12-15,19-20H2,1-3H3 |
| InChIKey | LIXTXNIXWVBXTL-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 129.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|