C19H21N5O5S — CID 58120149
[4-[[3-methoxycarbonyl-N-methyl-5-(1,2,4-triazol-1-ylmethyl)anilino]methyl]phenyl]sulfamic acid (PubChem CID 58120149) has the molecular formula C19H21N5O5S and a molecular weight of 431.47 g/mol. Its IUPAC name is [4-[[3-methoxycarbonyl-N-methyl-5-(1,2,4-triazol-1-ylmethyl)anilino]methyl]phenyl]sulfamic acid.
| Compound Name | [4-[[3-methoxycarbonyl-N-methyl-5-(1,2,4-triazol-1-ylmethyl)anilino]methyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 58120149 |
| Molecular Formula | C19H21N5O5S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | [4-[[3-methoxycarbonyl-N-methyl-5-(1,2,4-triazol-1-ylmethyl)anilino]methyl]phenyl]sulfamic acid |
| SMILES | COC(=O)c1cc(Cn2cncn2)cc(N(C)Cc2ccc(NS(=O)(=O)O)cc2)c1 |
| InChI | InChI=1S/C19H21N5O5S/c1-23(10-14-3-5-17(6-4-14)22-30(26,27)28)18-8-15(11-24-13-20-12-21-24)7-16(9-18)19(25)29-2/h3-9,12-13,22H,10-11H2,1-2H3,(H,26,27,28) |
| InChIKey | VPVYZYRBWZTKFE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|