C23H30O5 — CID 58120327
(1S,2R,11R,13R)-6,8-dihydroxy-11,14,14-trimethyl-7-(3-methylbutanoyl)-3-oxatetracyclo[11.1.1.02,11.04,9]pentadeca-4,6,8-triene-5-carbaldehyde (PubChem CID 58120327) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is (1S,2R,11R,13R)-6,8-dihydroxy-11,14,14-trimethyl-7-(3-methylbutanoyl)-3-oxatetracyclo[11.1.1.02,11.04,9]pentadeca-4,6,8-triene-5-carbaldehyde.
| Compound Name | (1S,2R,11R,13R)-6,8-dihydroxy-11,14,14-trimethyl-7-(3-methylbutanoyl)-3-oxatetracyclo[11.1.1.02,11.04,9]pentadeca-4,6,8-triene-5-carbaldehyde |
|---|---|
| PubChem CID | 58120327 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | (1S,2R,11R,13R)-6,8-dihydroxy-11,14,14-trimethyl-7-(3-methylbutanoyl)-3-oxatetracyclo[11.1.1.02,11.04,9]pentadeca-4,6,8-triene-5-carbaldehyde |
| SMILES | CC(C)CC(=O)c1c(O)c(C=O)c2c(c1O)C[C@@]1(C)C[C@H]3C[C@H]([C@H]1O2)C3(C)C |
| InChI | InChI=1S/C23H30O5/c1-11(2)6-16(25)17-18(26)13-9-23(5)8-12-7-15(22(12,3)4)21(23)28-20(13)14(10-24)19(17)27/h10-12,15,21,26-27H,6-9H2,1-5H3/t12-,15-,21-,23-/m1/s1 |
| InChIKey | PGWQZFNNOWFAGM-YIAQSYSQSA-N |
| XLogP | 4.51 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|