C23H19F17O6 — CID 58122163
2-[2-[difluoro-(1,1,1,2-tetrafluoro-3-oxohex-5-en-2-yl)oxymethyl]-1,1,3,3-tetrafluoro-2-methyl-3-(1,1,1-trifluoro-3-oxohex-5-en-2-yl)oxypropoxy]-1,1,1,2-tetrafluorohex-5-en-3-one (PubChem CID 58122163) has the molecular formula C23H19F17O6 and a molecular weight of 714.36 g/mol. Its IUPAC name is 2-[2-[difluoro-(1,1,1,2-tetrafluoro-3-oxohex-5-en-2-yl)oxymethyl]-1,1,3,3-tetrafluoro-2-methyl-3-(1,1,1-trifluoro-3-oxohex-5-en-2-yl)oxypropoxy]-1,1,1,2-tetrafluorohex-5-en-3-one.
| Compound Name | 2-[2-[difluoro-(1,1,1,2-tetrafluoro-3-oxohex-5-en-2-yl)oxymethyl]-1,1,3,3-tetrafluoro-2-methyl-3-(1,1,1-trifluoro-3-oxohex-5-en-2-yl)oxypropoxy]-1,1,1,2-tetrafluorohex-5-en-3-one |
|---|---|
| PubChem CID | 58122163 |
| Molecular Formula | C23H19F17O6 |
| Molecular Weight | 714.36 g/mol |
| Exact Mass | 714.09 |
| IUPAC Name | 2-[2-[difluoro-(1,1,1,2-tetrafluoro-3-oxohex-5-en-2-yl)oxymethyl]-1,1,3,3-tetrafluoro-2-methyl-3-(1,1,1-trifluoro-3-oxohex-5-en-2-yl)oxypropoxy]-1,1,1,2-tetrafluorohex-5-en-3-one |
| SMILES | C=CCC(=O)C(OC(F)(F)C(C)(C(F)(F)OC(F)(C(=O)CC=C)C(F)(F)F)C(F)(F)OC(F)(C(=O)CC=C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C23H19F17O6/c1-5-8-11(41)14(18(26,27)28)44-21(35,36)15(4,22(37,38)45-16(24,19(29,30)31)12(42)9-6-2)23(39,40)46-17(25,20(32,33)34)13(43)10-7-3/h5-7,14H,1-3,8-10H2,4H3 |
| InChIKey | CUEAGLKSNDEOFM-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.36 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|