C23H35F6O5S2- — CID 58122710
1,1,2,2,3,3-hexafluoro-3-(2,2,2-tricyclohexylethylsulfonyl)propane-1-sulfonate (PubChem CID 58122710) has the molecular formula C23H35F6O5S2- and a molecular weight of 569.65 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-(2,2,2-tricyclohexylethylsulfonyl)propane-1-sulfonate.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-(2,2,2-tricyclohexylethylsulfonyl)propane-1-sulfonate |
|---|---|
| PubChem CID | 58122710 |
| Molecular Formula | C23H35F6O5S2- |
| Molecular Weight | 569.65 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-(2,2,2-tricyclohexylethylsulfonyl)propane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)CC(C1CCCCC1)(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C23H36F6O5S2/c24-21(25,23(28,29)36(32,33)34)22(26,27)35(30,31)16-20(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h17-19H,1-16H2,(H,32,33,34)/p-1 |
| InChIKey | SGZSPUKZWJQDKI-UHFFFAOYSA-M |
| XLogP | 6.49 |
| TPSA | 91.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.65 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|