C16H22F6O2S — CID 157460405
1-[2-(1,1,2,2,3,3-hexafluorobutylsulfonyl)ethyl]adamantane (PubChem CID 157460405) has the molecular formula C16H22F6O2S and a molecular weight of 392.41 g/mol. Its IUPAC name is 1-[2-(1,1,2,2,3,3-hexafluorobutylsulfonyl)ethyl]adamantane.
| Compound Name | 1-[2-(1,1,2,2,3,3-hexafluorobutylsulfonyl)ethyl]adamantane |
|---|---|
| PubChem CID | 157460405 |
| Molecular Formula | C16H22F6O2S |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 1-[2-(1,1,2,2,3,3-hexafluorobutylsulfonyl)ethyl]adamantane |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)S(=O)(=O)CCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H22F6O2S/c1-13(17,18)15(19,20)16(21,22)25(23,24)3-2-14-7-10-4-11(8-14)6-12(5-10)9-14/h10-12H,2-9H2,1H3 |
| InChIKey | KEKSKSZGJIVTCT-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|