C14H20F4O3S — CID 89236167
1-(1-adamantyl)-3,3,4,4-tetrafluorobutane-1-sulfonic acid (PubChem CID 89236167) has the molecular formula C14H20F4O3S and a molecular weight of 344.37 g/mol. Its IUPAC name is 1-(1-adamantyl)-3,3,4,4-tetrafluorobutane-1-sulfonic acid.
| Compound Name | 1-(1-adamantyl)-3,3,4,4-tetrafluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 89236167 |
| Molecular Formula | C14H20F4O3S |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 1-(1-adamantyl)-3,3,4,4-tetrafluorobutane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(CC(F)(F)C(F)F)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C14H20F4O3S/c15-12(16)14(17,18)7-11(22(19,20)21)13-4-8-1-9(5-13)3-10(2-8)6-13/h8-12H,1-7H2,(H,19,20,21) |
| InChIKey | CJXKVNIWBWKKJC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|