C16H20F9NO4S2 — CID 58031145
N-[2-(1-adamantyl)ethylsulfonyl]-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide (PubChem CID 58031145) has the molecular formula C16H20F9NO4S2 and a molecular weight of 525.46 g/mol. Its IUPAC name is N-[2-(1-adamantyl)ethylsulfonyl]-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide.
| Compound Name | N-[2-(1-adamantyl)ethylsulfonyl]-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 58031145 |
| Molecular Formula | C16H20F9NO4S2 |
| Molecular Weight | 525.46 g/mol |
| Exact Mass | 525.07 |
| IUPAC Name | N-[2-(1-adamantyl)ethylsulfonyl]-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide |
| SMILES | O=S(=O)(CCC12CC3CC(CC(C3)C1)C2)NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H20F9NO4S2/c17-13(18,15(21,22)23)14(19,20)16(24,25)32(29,30)26-31(27,28)2-1-12-6-9-3-10(7-12)5-11(4-9)8-12/h9-11,26H,1-8H2 |
| InChIKey | FKSZFTYXNZWFEZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|