1-(1-adamantyl)-4,4,5,5-tetrafluoropentane-1-sulfonic acid

C15H22F4O3S — CID 142711172

IUPAC1-(1-adamantyl)-4,4,5,5-tetrafluoropentane-1-sulfonic acid
SMILESO=S(=O)(O)C(CCC(F)(F)C(F)F)C12CC3CC(CC(C3)C1)C2
InChIInChI=1S/C15H22F4O3S/c16-13(17)15(18,19)2-1-12(23(20,21)22)14-6-9-3-10(7-14)5-11(4-9)8-14/h9-13H,1-8H2,(H,20,21,22)
InChIKeyFJLUGYOSMLTJHQ-UHFFFAOYSA-N
MW358.40 g/mol
LogP4.14
Rot. Bonds6

About 1-(1-adamantyl)-4,4,5,5-tetrafluoropentane-1-sulfonic acid

1-(1-adamantyl)-4,4,5,5-tetrafluoropentane-1-sulfonic acid (PubChem CID 142711172) has the molecular formula C15H22F4O3S and a molecular weight of 358.40 g/mol. Its IUPAC name is 1-(1-adamantyl)-4,4,5,5-tetrafluoropentane-1-sulfonic acid.

Molecular Properties

Compound Name1-(1-adamantyl)-4,4,5,5-tetrafluoropentane-1-sulfonic acid
PubChem CID142711172
Molecular FormulaC15H22F4O3S
Molecular Weight358.40 g/mol
Exact Mass358.12
IUPAC Name1-(1-adamantyl)-4,4,5,5-tetrafluoropentane-1-sulfonic acid
SMILESO=S(=O)(O)C(CCC(F)(F)C(F)F)C12CC3CC(CC(C3)C1)C2
InChIInChI=1S/C15H22F4O3S/c16-13(17)15(18,19)2-1-12(23(20,21)22)14-6-9-3-10(7-14)5-11(4-9)8-14/h9-13H,1-8H2,(H,20,21,22)
InChIKeyFJLUGYOSMLTJHQ-UHFFFAOYSA-N
XLogP4.14
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500358.40
LogP ≤ 54.14
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 1-(1-adamantyl)-4,4,5,5-tetrafluoropentane-1-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(1-adamantyl)-4,4,5,5-tetrafluoropentane-1-sulfonic acid?
The IUPAC name of 1-(1-adamantyl)-4,4,5,5-tetrafluoropentane-1-sulfonic acid (CID 142711172) is 1-(1-adamantyl)-4,4,5,5-tetrafluoropentane-1-sulfonic acid.
What is the SMILES notation for 1-(1-adamantyl)-4,4,5,5-tetrafluoropentane-1-sulfonic acid?
The canonical SMILES for 1-(1-adamantyl)-4,4,5,5-tetrafluoropentane-1-sulfonic acid is O=S(=O)(O)C(CCC(F)(F)C(F)F)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-(1-adamantyl)-4,4,5,5-tetrafluoropentane-1-sulfonic acid?
The InChIKey is FJLUGYOSMLTJHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22F4O3S/c16-13(17)15(18,19)2-1-12(23(20,21)22)14-6-9-3-10(7-14)5-11(4-9)8-14/h9-13H,1-8H2,(H,20,21,22).
What are the key properties of 1-(1-adamantyl)-4,4,5,5-tetrafluoropentane-1-sulfonic acid?
1-(1-adamantyl)-4,4,5,5-tetrafluoropentane-1-sulfonic acid has a molecular weight of 358.40 g/mol, XLogP of 4.14, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-adamantyl)-4,4,5,5-tetrafluoropentane-1-sulfonic acid is sourced from PubChem (CID 142711172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).