C15H22F4O3S — CID 142711172
1-(1-adamantyl)-4,4,5,5-tetrafluoropentane-1-sulfonic acid (PubChem CID 142711172) has the molecular formula C15H22F4O3S and a molecular weight of 358.40 g/mol. Its IUPAC name is 1-(1-adamantyl)-4,4,5,5-tetrafluoropentane-1-sulfonic acid.
| Compound Name | 1-(1-adamantyl)-4,4,5,5-tetrafluoropentane-1-sulfonic acid |
|---|---|
| PubChem CID | 142711172 |
| Molecular Formula | C15H22F4O3S |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 1-(1-adamantyl)-4,4,5,5-tetrafluoropentane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(CCC(F)(F)C(F)F)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C15H22F4O3S/c16-13(17)15(18,19)2-1-12(23(20,21)22)14-6-9-3-10(7-14)5-11(4-9)8-14/h9-13H,1-8H2,(H,20,21,22) |
| InChIKey | FJLUGYOSMLTJHQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|