C14H17F6O5S2- — CID 58122696
3-(1-adamantylmethylsulfonyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfonate (PubChem CID 58122696) has the molecular formula C14H17F6O5S2- and a molecular weight of 443.41 g/mol. Its IUPAC name is 3-(1-adamantylmethylsulfonyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfonate.
| Compound Name | 3-(1-adamantylmethylsulfonyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 58122696 |
| Molecular Formula | C14H17F6O5S2- |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | 3-(1-adamantylmethylsulfonyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C14H18F6O5S2/c15-12(16,14(19,20)27(23,24)25)13(17,18)26(21,22)7-11-4-8-1-9(5-11)3-10(2-8)6-11/h8-10H,1-7H2,(H,23,24,25)/p-1 |
| InChIKey | ZJVHTPOBJXNYRI-UHFFFAOYSA-M |
| XLogP | 2.98 |
| TPSA | 91.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|