C14H14F9O6S3- — CID 59584319
1-fluoro-3-[1,1,2,2,2-pentafluoroethylsulfonyl(trifluoromethylsulfonyl)methyl]sulfonyladamantane (PubChem CID 59584319) has the molecular formula C14H14F9O6S3- and a molecular weight of 545.44 g/mol. Its IUPAC name is 1-fluoro-3-[1,1,2,2,2-pentafluoroethylsulfonyl(trifluoromethylsulfonyl)methyl]sulfonyladamantane.
| Compound Name | 1-fluoro-3-[1,1,2,2,2-pentafluoroethylsulfonyl(trifluoromethylsulfonyl)methyl]sulfonyladamantane |
|---|---|
| PubChem CID | 59584319 |
| Molecular Formula | C14H14F9O6S3- |
| Molecular Weight | 545.44 g/mol |
| Exact Mass | 544.98 |
| IUPAC Name | 1-fluoro-3-[1,1,2,2,2-pentafluoroethylsulfonyl(trifluoromethylsulfonyl)methyl]sulfonyladamantane |
| SMILES | O=S(=O)([C-](S(=O)(=O)C12CC3CC(CC(F)(C3)C1)C2)S(=O)(=O)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H14F9O6S3/c15-10-2-7-1-8(3-10)5-11(4-7,6-10)30(24,25)9(32(28,29)14(21,22)23)31(26,27)13(19,20)12(16,17)18/h7-8H,1-6H2/q-1 |
| InChIKey | GKHYQVJGCQCZPP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|