C13H17F4O6S3- — CID 59584256
1-fluoro-3-[methylsulfonyl(trifluoromethylsulfonyl)methyl]sulfonyladamantane (PubChem CID 59584256) has the molecular formula C13H17F4O6S3- and a molecular weight of 441.47 g/mol. Its IUPAC name is 1-fluoro-3-[methylsulfonyl(trifluoromethylsulfonyl)methyl]sulfonyladamantane.
| Compound Name | 1-fluoro-3-[methylsulfonyl(trifluoromethylsulfonyl)methyl]sulfonyladamantane |
|---|---|
| PubChem CID | 59584256 |
| Molecular Formula | C13H17F4O6S3- |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.01 |
| IUPAC Name | 1-fluoro-3-[methylsulfonyl(trifluoromethylsulfonyl)methyl]sulfonyladamantane |
| SMILES | CS(=O)(=O)[C-](S(=O)(=O)C(F)(F)F)S(=O)(=O)C12CC3CC(CC(F)(C3)C1)C2 |
| InChI | InChI=1S/C13H17F4O6S3/c1-24(18,19)10(26(22,23)13(15,16)17)25(20,21)12-5-8-2-9(6-12)4-11(14,3-8)7-12/h8-9H,2-7H2,1H3/q-1 |
| InChIKey | XYZSUJJRRUCTJF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|