C17H19F10O6S3- — CID 59584360
1-fluoro-3-[methylsulfonyl-[3,3,3-trifluoro-2,2-bis(trifluoromethyl)propyl]sulfonylmethyl]sulfonyladamantane (PubChem CID 59584360) has the molecular formula C17H19F10O6S3- and a molecular weight of 605.51 g/mol. Its IUPAC name is 1-fluoro-3-[methylsulfonyl-[3,3,3-trifluoro-2,2-bis(trifluoromethyl)propyl]sulfonylmethyl]sulfonyladamantane.
| Compound Name | 1-fluoro-3-[methylsulfonyl-[3,3,3-trifluoro-2,2-bis(trifluoromethyl)propyl]sulfonylmethyl]sulfonyladamantane |
|---|---|
| PubChem CID | 59584360 |
| Molecular Formula | C17H19F10O6S3- |
| Molecular Weight | 605.51 g/mol |
| Exact Mass | 605.02 |
| IUPAC Name | 1-fluoro-3-[methylsulfonyl-[3,3,3-trifluoro-2,2-bis(trifluoromethyl)propyl]sulfonylmethyl]sulfonyladamantane |
| SMILES | CS(=O)(=O)[C-](S(=O)(=O)CC(C(F)(F)F)(C(F)(F)F)C(F)(F)F)S(=O)(=O)C12CC3CC(CC(F)(C3)C1)C2 |
| InChI | InChI=1S/C17H19F10O6S3/c1-34(28,29)11(35(30,31)8-14(15(19,20)21,16(22,23)24)17(25,26)27)36(32,33)13-5-9-2-10(6-13)4-12(18,3-9)7-13/h9-10H,2-8H2,1H3/q-1 |
| InChIKey | YFCWCZFSWTXTFO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|