C13H14F7O6S3- — CID 59584270
1-[bis(trifluoromethylsulfonyl)methylsulfonyl]-3-fluoroadamantane (PubChem CID 59584270) has the molecular formula C13H14F7O6S3- and a molecular weight of 495.44 g/mol. Its IUPAC name is 1-[bis(trifluoromethylsulfonyl)methylsulfonyl]-3-fluoroadamantane.
| Compound Name | 1-[bis(trifluoromethylsulfonyl)methylsulfonyl]-3-fluoroadamantane |
|---|---|
| PubChem CID | 59584270 |
| Molecular Formula | C13H14F7O6S3- |
| Molecular Weight | 495.44 g/mol |
| Exact Mass | 494.98 |
| IUPAC Name | 1-[bis(trifluoromethylsulfonyl)methylsulfonyl]-3-fluoroadamantane |
| SMILES | O=S(=O)([C-](S(=O)(=O)C(F)(F)F)S(=O)(=O)C12CC3CC(CC(F)(C3)C1)C2)C(F)(F)F |
| InChI | InChI=1S/C13H14F7O6S3/c14-10-2-7-1-8(3-10)5-11(4-7,6-10)27(21,22)9(28(23,24)12(15,16)17)29(25,26)13(18,19)20/h7-8H,1-6H2/q-1 |
| InChIKey | BUNURPPCAIKLQG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|