C16H19F9NO4S2- — CID 58070705
2-(1-adamantyl)ethylsulfonyl-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)azanide (PubChem CID 58070705) has the molecular formula C16H19F9NO4S2- and a molecular weight of 524.45 g/mol. Its IUPAC name is 2-(1-adamantyl)ethylsulfonyl-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)azanide.
| Compound Name | 2-(1-adamantyl)ethylsulfonyl-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)azanide |
|---|---|
| PubChem CID | 58070705 |
| Molecular Formula | C16H19F9NO4S2- |
| Molecular Weight | 524.45 g/mol |
| Exact Mass | 524.06 |
| IUPAC Name | 2-(1-adamantyl)ethylsulfonyl-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)azanide |
| SMILES | O=S(=O)(CCC12CC3CC(CC(C3)C1)C2)[N-]S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H19F9NO4S2/c17-13(18,15(21,22)23)14(19,20)16(24,25)32(29,30)26-31(27,28)2-1-12-6-9-3-10(7-12)5-11(4-9)8-12/h9-11H,1-8H2/q-1 |
| InChIKey | PXZSGJJHVAWRPG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.45 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|