C15H21F4NaO3S — CID 142711171
sodium 1-(1-adamantyl)-4,4,5,5-tetrafluoropentane-1-sulfonate (PubChem CID 142711171) has the molecular formula C15H21F4NaO3S and a molecular weight of 380.38 g/mol. Its IUPAC name is sodium 1-(1-adamantyl)-4,4,5,5-tetrafluoropentane-1-sulfonate.
| Compound Name | sodium 1-(1-adamantyl)-4,4,5,5-tetrafluoropentane-1-sulfonate |
|---|---|
| PubChem CID | 142711171 |
| Molecular Formula | C15H21F4NaO3S |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | sodium 1-(1-adamantyl)-4,4,5,5-tetrafluoropentane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(CCC(F)(F)C(F)F)C12CC3CC(CC(C3)C1)C2.[Na+] |
| InChI | InChI=1S/C15H22F4O3S.Na/c16-13(17)15(18,19)2-1-12(23(20,21)22)14-6-9-3-10(7-14)5-11(4-9)8-14;/h9-13H,1-8H2,(H,20,21,22);/q;+1/p-1 |
| InChIKey | ADOWPDWXRRIUHV-UHFFFAOYSA-M |
| XLogP | 0.80 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|