C44H52FNO7 — CID 58123234
N-[(E,2S,3R)-3-fluoro-1-[(2R,3R,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyhept-4-en-2-yl]propanamide (PubChem CID 58123234) has the molecular formula C44H52FNO7 and a molecular weight of 725.90 g/mol. Its IUPAC name is N-[(E,2S,3R)-3-fluoro-1-[(2R,3R,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyhept-4-en-2-yl]propanamide.
| Compound Name | N-[(E,2S,3R)-3-fluoro-1-[(2R,3R,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyhept-4-en-2-yl]propanamide |
|---|---|
| PubChem CID | 58123234 |
| Molecular Formula | C44H52FNO7 |
| Molecular Weight | 725.90 g/mol |
| Exact Mass | 725.37 |
| IUPAC Name | N-[(E,2S,3R)-3-fluoro-1-[(2R,3R,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyhept-4-en-2-yl]propanamide |
| SMILES | CC/C=C/[C@@H](F)[C@H](CO[C@@H]1OC(COCc2ccccc2)[C@H](OCc2ccccc2)C(OCc2ccccc2)[C@H]1OCc1ccccc1)NC(=O)CC |
| InChI | InChI=1S/C44H52FNO7/c1-3-5-26-37(45)38(46-40(47)4-2)31-52-44-43(51-30-36-24-16-9-17-25-36)42(50-29-35-22-14-8-15-23-35)41(49-28-34-20-12-7-13-21-34)39(53-44)32-48-27-33-18-10-6-11-19-33/h5-26,37-39,41-44H,3-4,27-32H2,1-2H3,(H,46,47)/b26-5+/t37-,38+,39?,41+,42?,43-,44-/m1/s1 |
| InChIKey | VFSWJFMXRUNZSO-FDNDSQCXSA-N |
| XLogP | 7.90 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.90 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|