C38H46O9S — CID 58129810
[1-ethoxy-2-[4-[2-[4-[2-hydroxy-3-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]propoxy]phenyl]propan-2-yl]phenoxy]ethyl] hydrogen sulfate (PubChem CID 58129810) has the molecular formula C38H46O9S and a molecular weight of 678.84 g/mol. Its IUPAC name is [1-ethoxy-2-[4-[2-[4-[2-hydroxy-3-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]propoxy]phenyl]propan-2-yl]phenoxy]ethyl] hydrogen sulfate.
| Compound Name | [1-ethoxy-2-[4-[2-[4-[2-hydroxy-3-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]propoxy]phenyl]propan-2-yl]phenoxy]ethyl] hydrogen sulfate |
|---|---|
| PubChem CID | 58129810 |
| Molecular Formula | C38H46O9S |
| Molecular Weight | 678.84 g/mol |
| Exact Mass | 678.29 |
| IUPAC Name | [1-ethoxy-2-[4-[2-[4-[2-hydroxy-3-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]propoxy]phenyl]propan-2-yl]phenoxy]ethyl] hydrogen sulfate |
| SMILES | CCOC(COc1ccc(C(C)(C)c2ccc(OCC(O)COc3ccc(C(C)(C)c4ccc(C)cc4)cc3)cc2)cc1)OS(=O)(=O)O |
| InChI | InChI=1S/C38H46O9S/c1-7-43-36(47-48(40,41)42)26-46-35-22-16-31(17-23-35)38(5,6)30-14-20-34(21-15-30)45-25-32(39)24-44-33-18-12-29(13-19-33)37(3,4)28-10-8-27(2)9-11-28/h8-23,32,36,39H,7,24-26H2,1-6H3,(H,40,41,42) |
| InChIKey | LWKIJMXUQKEGDP-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.84 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|